| Category: | Sesquiterpenoids | |
|---|---|---|
| Appearance: | powder | |
| Purity: | 95~98%(HPLC) | |
| Storage conditions: | -20°C under seal save, placed in ventilated, dry environment | |
| Application: | All our products are for research and lab only. Injecting, eating and other ways are forbidden. | |
| Package: | 5mg,10mg ,20mg ,50mg ,100mg,1g, 100g or customized | |
| SMILES: | O=C1C[C@@]2(C[C@]3(O)OC(=O)C(C)=C3C[C@H]2C(C)=C1)C |