| Solubility： | Soluble in water, alcohol, ethyl acetate, acetone, dimethylformamide, benzene, ether and chloroform. | |
|---|---|---|
| Category： | Natural products | |
| Appearance： | powder | |
| Purity： | 95~98%(HPLC) | |
| Storage conditions： | -20°C under seal save, placed in ventilated, dry environment | |
| Application： | All our products are for research and lab only. Injecting, eating and other ways are forbidden. | |
| Package： | 5mg,10mg ,20mg ,50mg ,100mg,1g, 100g or customized | |
| SMILES： | O1C(C([H])=O)=C([H])C([H])=C1C([H])([H])O[H] |
